C14H16BrF3O — CID 62394805
2-bromo-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pentan-3-one (PubChem CID 62394805) has the molecular formula C14H16BrF3O and a molecular weight of 337.18 g/mol. Its IUPAC name is 2-bromo-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pentan-3-one.
| Compound Name | 2-bromo-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 62394805 |
| Molecular Formula | C14H16BrF3O |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-bromo-4,4-dimethyl-1-[4-(trifluoromethyl)phenyl]pentan-3-one |
| SMILES | CC(C)(C)C(=O)C(Br)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16BrF3O/c1-13(2,3)12(19)11(15)8-9-4-6-10(7-5-9)14(16,17)18/h4-7,11H,8H2,1-3H3 |
| InChIKey | AKVSHCNIJQLXCN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|