C15H21F3O2 — CID 116752705
3-ethyl-3-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-2-ol (PubChem CID 116752705) has the molecular formula C15H21F3O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-ethyl-3-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-2-ol.
| Compound Name | 3-ethyl-3-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 116752705 |
| Molecular Formula | C15H21F3O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3-ethyl-3-methoxy-1-[4-(trifluoromethyl)phenyl]pentan-2-ol |
| SMILES | CCC(CC)(OC)C(O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3O2/c1-4-14(5-2,20-3)13(19)10-11-6-8-12(9-7-11)15(16,17)18/h6-9,13,19H,4-5,10H2,1-3H3 |
| InChIKey | HEOVNQCELUJVFR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |