C13H17F3OS — CID 114222114
3-methyl-4-methylsulfanyl-1-[4-(trifluoromethyl)phenyl]butan-2-ol (PubChem CID 114222114) has the molecular formula C13H17F3OS and a molecular weight of 278.34 g/mol. Its IUPAC name is 3-methyl-4-methylsulfanyl-1-[4-(trifluoromethyl)phenyl]butan-2-ol.
| Compound Name | 3-methyl-4-methylsulfanyl-1-[4-(trifluoromethyl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 114222114 |
| Molecular Formula | C13H17F3OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-methyl-4-methylsulfanyl-1-[4-(trifluoromethyl)phenyl]butan-2-ol |
| SMILES | CSCC(C)C(O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3OS/c1-9(8-18-2)12(17)7-10-3-5-11(6-4-10)13(14,15)16/h3-6,9,12,17H,7-8H2,1-2H3 |
| InChIKey | IIFCGAXLUBLJTP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |