C12H12F6O — CID 79953429
5,5,5-trifluoro-1-[4-(trifluoromethyl)phenyl]pentan-2-ol (PubChem CID 79953429) has the molecular formula C12H12F6O and a molecular weight of 286.22 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[4-(trifluoromethyl)phenyl]pentan-2-ol.
| Compound Name | 5,5,5-trifluoro-1-[4-(trifluoromethyl)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 79953429 |
| Molecular Formula | C12H12F6O |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 5,5,5-trifluoro-1-[4-(trifluoromethyl)phenyl]pentan-2-ol |
| SMILES | OC(CCC(F)(F)F)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F6O/c13-11(14,15)6-5-10(19)7-8-1-3-9(4-2-8)12(16,17)18/h1-4,10,19H,5-7H2 |
| InChIKey | RRTCVDJZUCXJSR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |