C15H21F3O — CID 79952878
1-(4-tert-butylphenyl)-5,5,5-trifluoropentan-2-ol (PubChem CID 79952878) has the molecular formula C15H21F3O and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-5,5,5-trifluoropentan-2-ol.
| Compound Name | 1-(4-tert-butylphenyl)-5,5,5-trifluoropentan-2-ol |
|---|---|
| PubChem CID | 79952878 |
| Molecular Formula | C15H21F3O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-(4-tert-butylphenyl)-5,5,5-trifluoropentan-2-ol |
| SMILES | CC(C)(C)c1ccc(CC(O)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3O/c1-14(2,3)12-6-4-11(5-7-12)10-13(19)8-9-15(16,17)18/h4-7,13,19H,8-10H2,1-3H3 |
| InChIKey | QGQNHKKLKCRDPQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |