C13H17F3O — CID 94905405
(2R)-3-(4-tert-butylphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 94905405) has the molecular formula C13H17F3O and a molecular weight of 246.27 g/mol. Its IUPAC name is (2R)-3-(4-tert-butylphenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-3-(4-tert-butylphenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 94905405 |
| Molecular Formula | C13H17F3O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (2R)-3-(4-tert-butylphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(C)(C)c1ccc(C[C@@H](O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3O/c1-12(2,3)10-6-4-9(5-7-10)8-11(17)13(14,15)16/h4-7,11,17H,8H2,1-3H3/t11-/m1/s1 |
| InChIKey | SZDOUWRVRUCKFK-LLVKDONJSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |