C9H8ClF3O — CID 94905407
(2S)-3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 94905407) has the molecular formula C9H8ClF3O and a molecular weight of 224.61 g/mol. Its IUPAC name is (2S)-3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 94905407 |
| Molecular Formula | C9H8ClF3O |
| Molecular Weight | 224.61 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | (2S)-3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@@H](Cc1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H8ClF3O/c10-7-3-1-6(2-4-7)5-8(14)9(11,12)13/h1-4,8,14H,5H2/t8-/m0/s1 |
| InChIKey | IYYUIIVBJNRBSG-QMMMGPOBSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |