C10H8ClF3O — CID 115041825
2-[(4-chlorophenyl)methyl]-3,3,3-trifluoropropanal (PubChem CID 115041825) has the molecular formula C10H8ClF3O and a molecular weight of 236.62 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-3,3,3-trifluoropropanal.
| Compound Name | 2-[(4-chlorophenyl)methyl]-3,3,3-trifluoropropanal |
|---|---|
| PubChem CID | 115041825 |
| Molecular Formula | C10H8ClF3O |
| Molecular Weight | 236.62 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-3,3,3-trifluoropropanal |
| SMILES | O=CC(Cc1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H8ClF3O/c11-9-3-1-7(2-4-9)5-8(6-15)10(12,13)14/h1-4,6,8H,5H2 |
| InChIKey | KFRJJDJRKNGDTE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|