C11H8F6O — CID 46201312
(2S)-3,3,3-trifluoro-2-[[4-(trifluoromethyl)phenyl]methyl]propanal (PubChem CID 46201312) has the molecular formula C11H8F6O and a molecular weight of 270.17 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-2-[[4-(trifluoromethyl)phenyl]methyl]propanal.
| Compound Name | (2S)-3,3,3-trifluoro-2-[[4-(trifluoromethyl)phenyl]methyl]propanal |
|---|---|
| PubChem CID | 46201312 |
| Molecular Formula | C11H8F6O |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-[[4-(trifluoromethyl)phenyl]methyl]propanal |
| SMILES | O=C[C@H](Cc1ccc(C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H8F6O/c12-10(13,14)8-3-1-7(2-4-8)5-9(6-18)11(15,16)17/h1-4,6,9H,5H2/t9-/m0/s1 |
| InChIKey | CKFBPGUHKDZYBV-VIFPVBQESA-N |
| XLogP | 3.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|