C11H11F3O — CID 115029432
3,3,3-trifluoro-2-[(4-methylphenyl)methyl]propanal (PubChem CID 115029432) has the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(4-methylphenyl)methyl]propanal.
| Compound Name | 3,3,3-trifluoro-2-[(4-methylphenyl)methyl]propanal |
|---|---|
| PubChem CID | 115029432 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3,3,3-trifluoro-2-[(4-methylphenyl)methyl]propanal |
| SMILES | Cc1ccc(CC(C=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3O/c1-8-2-4-9(5-3-8)6-10(7-15)11(12,13)14/h2-5,7,10H,6H2,1H3 |
| InChIKey | QROIPFPPHOYLRZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|