C9H10Cl2F2 — CID 161479390
dichloro(difluoro)methane;1,4-xylene (PubChem CID 161479390) has the molecular formula C9H10Cl2F2 and a molecular weight of 227.08 g/mol. Its IUPAC name is dichloro(difluoro)methane;1,4-xylene.
| Compound Name | dichloro(difluoro)methane;1,4-xylene |
|---|---|
| PubChem CID | 161479390 |
| Molecular Formula | C9H10Cl2F2 |
| Molecular Weight | 227.08 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | dichloro(difluoro)methane;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.FC(F)(Cl)Cl |
| InChI | InChI=1S/C8H10.CCl2F2/c1-7-3-5-8(2)6-4-7;2-1(3,4)5/h3-6H,1-2H3; |
| InChIKey | WEDQCCNYPSJIJB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.08 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|