About platinum;1,4-xylene
platinum;1,4-xylene (PubChem CID 173034643) has the molecular formula C8H10Pt
and a molecular weight of 301.25 g/mol. Its IUPAC name is platinum;1,4-xylene.
Molecular Properties
| Compound Name | platinum;1,4-xylene |
| PubChem CID | 173034643 |
| Molecular Formula | C8H10Pt |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | platinum;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.[Pt] |
| InChI | InChI=1S/C8H10.Pt/c1-7-3-5-8(2)6-4-7;/h3-6H,1-2H3; |
| InChIKey | CHLVBWYYCLEXDE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze platinum;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;1,4-xylene?
The IUPAC name of platinum;1,4-xylene (CID 173034643) is platinum;1,4-xylene.
What is the SMILES notation for platinum;1,4-xylene?
The canonical SMILES for platinum;1,4-xylene is Cc1ccc(C)cc1.[Pt].
What is the InChIKey of platinum;1,4-xylene?
The InChIKey is CHLVBWYYCLEXDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.Pt/c1-7-3-5-8(2)6-4-7;/h3-6H,1-2H3;.
What are the key properties of platinum;1,4-xylene?
platinum;1,4-xylene has a molecular weight of 301.25 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;1,4-xylene is sourced from PubChem (CID 173034643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).