About lithium;hydride;1,4-xylene
lithium;hydride;1,4-xylene (PubChem CID 173349078) has the molecular formula C8H11Li
and a molecular weight of 114.12 g/mol. Its IUPAC name is lithium;hydride;1,4-xylene.
Molecular Properties
| Compound Name | lithium;hydride;1,4-xylene |
| PubChem CID | 173349078 |
| Molecular Formula | C8H11Li |
| Molecular Weight | 114.12 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | lithium;hydride;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.[H-].[Li+] |
| InChI | InChI=1S/C8H10.Li.H/c1-7-3-5-8(2)6-4-7;;/h3-6H,1-2H3;;/q;+1;-1 |
| InChIKey | OQTDTADKGTULKE-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.12 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium;hydride;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;1,4-xylene?
The IUPAC name of lithium;hydride;1,4-xylene (CID 173349078) is lithium;hydride;1,4-xylene.
What is the SMILES notation for lithium;hydride;1,4-xylene?
The canonical SMILES for lithium;hydride;1,4-xylene is Cc1ccc(C)cc1.[H-].[Li+].
What is the InChIKey of lithium;hydride;1,4-xylene?
The InChIKey is OQTDTADKGTULKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.Li.H/c1-7-3-5-8(2)6-4-7;;/h3-6H,1-2H3;;/q;+1;-1.
What are the key properties of lithium;hydride;1,4-xylene?
lithium;hydride;1,4-xylene has a molecular weight of 114.12 g/mol, XLogP of -0.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;1,4-xylene is sourced from PubChem (CID 173349078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).