About potassium;hydride;1,4-xylene
potassium;hydride;1,4-xylene (PubChem CID 173420414) has the molecular formula C8H11K
and a molecular weight of 146.27 g/mol. Its IUPAC name is potassium;hydride;1,4-xylene.
Molecular Properties
| Compound Name | potassium;hydride;1,4-xylene |
| PubChem CID | 173420414 |
| Molecular Formula | C8H11K |
| Molecular Weight | 146.27 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | potassium;hydride;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.[H-].[K+] |
| InChI | InChI=1S/C8H10.K.H/c1-7-3-5-8(2)6-4-7;;/h3-6H,1-2H3;;/q;+1;-1 |
| InChIKey | NLZZYCQYMQAFNM-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze potassium;hydride;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;1,4-xylene?
The IUPAC name of potassium;hydride;1,4-xylene (CID 173420414) is potassium;hydride;1,4-xylene.
What is the SMILES notation for potassium;hydride;1,4-xylene?
The canonical SMILES for potassium;hydride;1,4-xylene is Cc1ccc(C)cc1.[H-].[K+].
What is the InChIKey of potassium;hydride;1,4-xylene?
The InChIKey is NLZZYCQYMQAFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.K.H/c1-7-3-5-8(2)6-4-7;;/h3-6H,1-2H3;;/q;+1;-1.
What are the key properties of potassium;hydride;1,4-xylene?
potassium;hydride;1,4-xylene has a molecular weight of 146.27 g/mol, XLogP of -0.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;1,4-xylene is sourced from PubChem (CID 173420414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).