About cobalt;bis(1,4-xylene)
cobalt;bis(1,4-xylene) (PubChem CID 67859603) has the molecular formula C16H20Co
and a molecular weight of 271.27 g/mol. Its IUPAC name is cobalt;bis(1,4-xylene).
Molecular Properties
| Compound Name | cobalt;bis(1,4-xylene) |
| PubChem CID | 67859603 |
| Molecular Formula | C16H20Co |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | cobalt;bis(1,4-xylene) |
| SMILES | Cc1ccc(C)cc1.Cc1ccc(C)cc1.[Co] |
| InChI | InChI=1S/2C8H10.Co/c2*1-7-3-5-8(2)6-4-7;/h2*3-6H,1-2H3; |
| InChIKey | BFVNASQMDPPYNN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cobalt;bis(1,4-xylene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(1,4-xylene)?
The IUPAC name of cobalt;bis(1,4-xylene) (CID 67859603) is cobalt;bis(1,4-xylene).
What is the SMILES notation for cobalt;bis(1,4-xylene)?
The canonical SMILES for cobalt;bis(1,4-xylene) is Cc1ccc(C)cc1.Cc1ccc(C)cc1.[Co].
What is the InChIKey of cobalt;bis(1,4-xylene)?
The InChIKey is BFVNASQMDPPYNN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H10.Co/c2*1-7-3-5-8(2)6-4-7;/h2*3-6H,1-2H3;.
What are the key properties of cobalt;bis(1,4-xylene)?
cobalt;bis(1,4-xylene) has a molecular weight of 271.27 g/mol, XLogP of 4.60, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(1,4-xylene) is sourced from PubChem (CID 67859603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).