C11H20 — CID 170763925
molecular hydrogen;propane;1,4-xylene (PubChem CID 170763925) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is molecular hydrogen;propane;1,4-xylene.
| Compound Name | molecular hydrogen;propane;1,4-xylene |
|---|---|
| PubChem CID | 170763925 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | molecular hydrogen;propane;1,4-xylene |
| SMILES | CCC.Cc1ccc(C)cc1.[H][H] |
| InChI | InChI=1S/C8H10.C3H8.H2/c1-7-3-5-8(2)6-4-7;1-3-2;/h3-6H,1-2H3;3H2,1-2H3;1H |
| InChIKey | SDAFTQSGIUKJHK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |