C9H8Br2ClF — CID 23234190
1-[(1R,2S)-1,2-dibromo-2-chloro-2-fluoroethyl]-4-methylbenzene (PubChem CID 23234190) has the molecular formula C9H8Br2ClF and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-[(1R,2S)-1,2-dibromo-2-chloro-2-fluoroethyl]-4-methylbenzene.
| Compound Name | 1-[(1R,2S)-1,2-dibromo-2-chloro-2-fluoroethyl]-4-methylbenzene |
|---|---|
| PubChem CID | 23234190 |
| Molecular Formula | C9H8Br2ClF |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 327.87 |
| IUPAC Name | 1-[(1R,2S)-1,2-dibromo-2-chloro-2-fluoroethyl]-4-methylbenzene |
| SMILES | Cc1ccc([C@@H](Br)[C@](F)(Cl)Br)cc1 |
| InChI | InChI=1S/C9H8Br2ClF/c1-6-2-4-7(5-3-6)8(10)9(11,12)13/h2-5,8H,1H3/t8-,9-/m1/s1 |
| InChIKey | MSGPUPSSBJOFJO-RKDXNWHRSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|