C11H10F3N — CID 125492404
(2R)-4,4,4-trifluoro-2-(4-methylphenyl)butanenitrile (PubChem CID 125492404) has the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. Its IUPAC name is (2R)-4,4,4-trifluoro-2-(4-methylphenyl)butanenitrile.
| Compound Name | (2R)-4,4,4-trifluoro-2-(4-methylphenyl)butanenitrile |
|---|---|
| PubChem CID | 125492404 |
| Molecular Formula | C11H10F3N |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (2R)-4,4,4-trifluoro-2-(4-methylphenyl)butanenitrile |
| SMILES | Cc1ccc([C@H](C#N)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3N/c1-8-2-4-9(5-3-8)10(7-15)6-11(12,13)14/h2-5,10H,6H2,1H3/t10-/m0/s1 |
| InChIKey | WPQGJEXBCIPBFW-JTQLQIEISA-N |
| XLogP | 3.55 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |