C17H16FN — CID 82141326
3-(2,5-dimethylphenyl)-2-(4-fluorophenyl)propanenitrile (PubChem CID 82141326) has the molecular formula C17H16FN and a molecular weight of 253.32 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-2-(4-fluorophenyl)propanenitrile.
| Compound Name | 3-(2,5-dimethylphenyl)-2-(4-fluorophenyl)propanenitrile |
|---|---|
| PubChem CID | 82141326 |
| Molecular Formula | C17H16FN |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-2-(4-fluorophenyl)propanenitrile |
| SMILES | Cc1ccc(C)c(CC(C#N)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H16FN/c1-12-3-4-13(2)15(9-12)10-16(11-19)14-5-7-17(18)8-6-14/h3-9,16H,10H2,1-2H3 |
| InChIKey | AUAASUJFGKCGJZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |