C16H15NO3 — CID 82141341
5-[1-cyano-2-(2,5-dimethylphenyl)ethyl]furan-2-carboxylic acid (PubChem CID 82141341) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-[1-cyano-2-(2,5-dimethylphenyl)ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-cyano-2-(2,5-dimethylphenyl)ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 82141341 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 5-[1-cyano-2-(2,5-dimethylphenyl)ethyl]furan-2-carboxylic acid |
| SMILES | Cc1ccc(C)c(CC(C#N)c2ccc(C(=O)O)o2)c1 |
| InChI | InChI=1S/C16H15NO3/c1-10-3-4-11(2)12(7-10)8-13(9-17)14-5-6-15(20-14)16(18)19/h3-7,13H,8H2,1-2H3,(H,18,19) |
| InChIKey | APIVBGGHQSFHON-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |