C15H16O3 — CID 21387641
5-[1-(2,4-dimethylphenyl)ethyl]furan-2-carboxylic acid (PubChem CID 21387641) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-[1-(2,4-dimethylphenyl)ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-(2,4-dimethylphenyl)ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 21387641 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5-[1-(2,4-dimethylphenyl)ethyl]furan-2-carboxylic acid |
| SMILES | Cc1ccc(C(C)c2ccc(C(=O)O)o2)c(C)c1 |
| InChI | InChI=1S/C15H16O3/c1-9-4-5-12(10(2)8-9)11(3)13-6-7-14(18-13)15(16)17/h4-8,11H,1-3H3,(H,16,17) |
| InChIKey | UWFXBXWQUPCNKL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |