C18H22O4 — CID 20985835
5-[1-(2-tert-butyl-5-methylphenoxy)ethyl]furan-2-carboxylic acid (PubChem CID 20985835) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 5-[1-(2-tert-butyl-5-methylphenoxy)ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-(2-tert-butyl-5-methylphenoxy)ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 20985835 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-[1-(2-tert-butyl-5-methylphenoxy)ethyl]furan-2-carboxylic acid |
| SMILES | Cc1ccc(C(C)(C)C)c(OC(C)c2ccc(C(=O)O)o2)c1 |
| InChI | InChI=1S/C18H22O4/c1-11-6-7-13(18(3,4)5)16(10-11)21-12(2)14-8-9-15(22-14)17(19)20/h6-10,12H,1-5H3,(H,19,20) |
| InChIKey | OHRGTWLRDFZCPK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |