3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid

C17H17FO3 — CID 139841985

IUPAC3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid
SMILESCc1ccc(C(C)c2cc(F)cc(C(=O)O)c2O)c(C)c1
InChIInChI=1S/C17H17FO3/c1-9-4-5-13(10(2)6-9)11(3)14-7-12(18)8-15(16(14)19)17(20)21/h4-8,11,19H,1-3H3,(H,20,21)
InChIKeyCSZAKZYVVMJMRD-UHFFFAOYSA-N
MW288.32 g/mol
LogP4.00
Rot. Bonds3

About 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid

3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid (PubChem CID 139841985) has the molecular formula C17H17FO3 and a molecular weight of 288.32 g/mol. Its IUPAC name is 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid.

Molecular Properties

Compound Name3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid
PubChem CID139841985
Molecular FormulaC17H17FO3
Molecular Weight288.32 g/mol
Exact Mass288.12
IUPAC Name3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid
SMILESCc1ccc(C(C)c2cc(F)cc(C(=O)O)c2O)c(C)c1
InChIInChI=1S/C17H17FO3/c1-9-4-5-13(10(2)6-9)11(3)14-7-12(18)8-15(16(14)19)17(20)21/h4-8,11,19H,1-3H3,(H,20,21)
InChIKeyCSZAKZYVVMJMRD-UHFFFAOYSA-N
XLogP4.00
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.32
LogP ≤ 54.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid?
The IUPAC name of 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid (CID 139841985) is 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid.
What is the SMILES notation for 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid?
The canonical SMILES for 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid is Cc1ccc(C(C)c2cc(F)cc(C(=O)O)c2O)c(C)c1.
What is the InChIKey of 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid?
The InChIKey is CSZAKZYVVMJMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FO3/c1-9-4-5-13(10(2)6-9)11(3)14-7-12(18)8-15(16(14)19)17(20)21/h4-8,11,19H,1-3H3,(H,20,21).
What are the key properties of 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid?
3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid has a molecular weight of 288.32 g/mol, XLogP of 4.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,4-dimethylphenyl)ethyl]-5-fluoro-2-hydroxybenzoic acid is sourced from PubChem (CID 139841985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).