C23H21FO3 — CID 139749469
3-(1,3-diphenylbutyl)-5-fluoro-2-hydroxybenzoic acid (PubChem CID 139749469) has the molecular formula C23H21FO3 and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-(1,3-diphenylbutyl)-5-fluoro-2-hydroxybenzoic acid.
| Compound Name | 3-(1,3-diphenylbutyl)-5-fluoro-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 139749469 |
| Molecular Formula | C23H21FO3 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-(1,3-diphenylbutyl)-5-fluoro-2-hydroxybenzoic acid |
| SMILES | CC(CC(c1ccccc1)c1cc(F)cc(C(=O)O)c1O)c1ccccc1 |
| InChI | InChI=1S/C23H21FO3/c1-15(16-8-4-2-5-9-16)12-19(17-10-6-3-7-11-17)20-13-18(24)14-21(22(20)25)23(26)27/h2-11,13-15,19,25H,12H2,1H3,(H,26,27) |
| InChIKey | XLXOEBYHDDEALP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |