C31H30O4 — CID 139749478
5-(1,3-diphenylbutyl)-2-hydroxy-3-[(4-methoxyphenyl)methyl]benzoic acid (PubChem CID 139749478) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 5-(1,3-diphenylbutyl)-2-hydroxy-3-[(4-methoxyphenyl)methyl]benzoic acid.
| Compound Name | 5-(1,3-diphenylbutyl)-2-hydroxy-3-[(4-methoxyphenyl)methyl]benzoic acid |
|---|---|
| PubChem CID | 139749478 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 5-(1,3-diphenylbutyl)-2-hydroxy-3-[(4-methoxyphenyl)methyl]benzoic acid |
| SMILES | COc1ccc(Cc2cc(C(CC(C)c3ccccc3)c3ccccc3)cc(C(=O)O)c2O)cc1 |
| InChI | InChI=1S/C31H30O4/c1-21(23-9-5-3-6-10-23)17-28(24-11-7-4-8-12-24)25-19-26(30(32)29(20-25)31(33)34)18-22-13-15-27(35-2)16-14-22/h3-16,19-21,28,32H,17-18H2,1-2H3,(H,33,34) |
| InChIKey | CKYHHYSVCYBUBH-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |