C33H34O3 — CID 139751253
3-benzyl-5-[bis(4-propan-2-ylphenyl)methyl]-2-hydroxybenzoic acid (PubChem CID 139751253) has the molecular formula C33H34O3 and a molecular weight of 478.63 g/mol. Its IUPAC name is 3-benzyl-5-[bis(4-propan-2-ylphenyl)methyl]-2-hydroxybenzoic acid.
| Compound Name | 3-benzyl-5-[bis(4-propan-2-ylphenyl)methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 139751253 |
| Molecular Formula | C33H34O3 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 3-benzyl-5-[bis(4-propan-2-ylphenyl)methyl]-2-hydroxybenzoic acid |
| SMILES | CC(C)c1ccc(C(c2ccc(C(C)C)cc2)c2cc(Cc3ccccc3)c(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C33H34O3/c1-21(2)24-10-14-26(15-11-24)31(27-16-12-25(13-17-27)22(3)4)28-19-29(18-23-8-6-5-7-9-23)32(34)30(20-28)33(35)36/h5-17,19-22,31,34H,18H2,1-4H3,(H,35,36) |
| InChIKey | KSDOYKSUHHCRFP-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|