3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid

C37H34O3 — CID 19889320

IUPAC3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid
SMILESCC(c1cc(C(=O)O)c(O)c(C(C)c2ccccc2Cc2ccccc2)c1)c1ccccc1Cc1ccccc1
InChIInChI=1S/C37H34O3/c1-25(32-19-11-9-17-29(32)21-27-13-5-3-6-14-27)31-23-34(36(38)35(24-31)37(39)40)26(2)33-20-12-10-18-30(33)22-28-15-7-4-8-16-28/h3-20,23-26,38H,21-22H2,1-2H3,(H,39,40)
InChIKeyVOEDFZMFNBDIQZ-UHFFFAOYSA-N
MW526.68 g/mol
LogP8.58
Rot. Bonds9

About 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid

3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid (PubChem CID 19889320) has the molecular formula C37H34O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid.

Molecular Properties

Compound Name3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid
PubChem CID19889320
Molecular FormulaC37H34O3
Molecular Weight526.68 g/mol
Exact Mass526.25
IUPAC Name3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid
SMILESCC(c1cc(C(=O)O)c(O)c(C(C)c2ccccc2Cc2ccccc2)c1)c1ccccc1Cc1ccccc1
InChIInChI=1S/C37H34O3/c1-25(32-19-11-9-17-29(32)21-27-13-5-3-6-14-27)31-23-34(36(38)35(24-31)37(39)40)26(2)33-20-12-10-18-30(33)22-28-15-7-4-8-16-28/h3-20,23-26,38H,21-22H2,1-2H3,(H,39,40)
InChIKeyVOEDFZMFNBDIQZ-UHFFFAOYSA-N
XLogP8.58
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms40
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500526.68
LogP ≤ 58.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid?
The IUPAC name of 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid (CID 19889320) is 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid.
What is the SMILES notation for 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid?
The canonical SMILES for 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid is CC(c1cc(C(=O)O)c(O)c(C(C)c2ccccc2Cc2ccccc2)c1)c1ccccc1Cc1ccccc1.
What is the InChIKey of 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid?
The InChIKey is VOEDFZMFNBDIQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H34O3/c1-25(32-19-11-9-17-29(32)21-27-13-5-3-6-14-27)31-23-34(36(38)35(24-31)37(39)40)26(2)33-20-12-10-18-30(33)22-28-15-7-4-8-16-28/h3-20,23-26,38H,21-22H2,1-2H3,(H,39,40).
What are the key properties of 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid?
3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid has a molecular weight of 526.68 g/mol, XLogP of 8.58, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid is sourced from PubChem (CID 19889320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).