C37H34O3 — CID 19889320
3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid (PubChem CID 19889320) has the molecular formula C37H34O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid.
| Compound Name | 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19889320 |
| Molecular Formula | C37H34O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 3,5-bis[1-(2-benzylphenyl)ethyl]-2-hydroxybenzoic acid |
| SMILES | CC(c1cc(C(=O)O)c(O)c(C(C)c2ccccc2Cc2ccccc2)c1)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C37H34O3/c1-25(32-19-11-9-17-29(32)21-27-13-5-3-6-14-27)31-23-34(36(38)35(24-31)37(39)40)26(2)33-20-12-10-18-30(33)22-28-15-7-4-8-16-28/h3-20,23-26,38H,21-22H2,1-2H3,(H,39,40) |
| InChIKey | VOEDFZMFNBDIQZ-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |