C21H26O3 — CID 150931941
3-hexan-2-yl-2-hydroxy-5-(1-phenylethyl)benzoic acid (PubChem CID 150931941) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-hexan-2-yl-2-hydroxy-5-(1-phenylethyl)benzoic acid.
| Compound Name | 3-hexan-2-yl-2-hydroxy-5-(1-phenylethyl)benzoic acid |
|---|---|
| PubChem CID | 150931941 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 3-hexan-2-yl-2-hydroxy-5-(1-phenylethyl)benzoic acid |
| SMILES | CCCCC(C)c1cc(C(C)c2ccccc2)cc(C(=O)O)c1O |
| InChI | InChI=1S/C21H26O3/c1-4-5-9-14(2)18-12-17(13-19(20(18)22)21(23)24)15(3)16-10-7-6-8-11-16/h6-8,10-15,22H,4-5,9H2,1-3H3,(H,23,24) |
| InChIKey | LGFHIGGUDKTCTG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |