C24H24O3 — CID 19770533
2-hydroxy-5-(1-phenylethyl)-3-(2-phenylpropan-2-yl)benzoic acid (PubChem CID 19770533) has the molecular formula C24H24O3 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-hydroxy-5-(1-phenylethyl)-3-(2-phenylpropan-2-yl)benzoic acid.
| Compound Name | 2-hydroxy-5-(1-phenylethyl)-3-(2-phenylpropan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 19770533 |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-hydroxy-5-(1-phenylethyl)-3-(2-phenylpropan-2-yl)benzoic acid |
| SMILES | CC(c1ccccc1)c1cc(C(=O)O)c(O)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C24H24O3/c1-16(17-10-6-4-7-11-17)18-14-20(23(26)27)22(25)21(15-18)24(2,3)19-12-8-5-9-13-19/h4-16,25H,1-3H3,(H,26,27) |
| InChIKey | YTZGNAVANGDQDE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |