C25H28O4Zn — CID 67943288
2-hydroxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid;zinc;hydrate (PubChem CID 67943288) has the molecular formula C25H28O4Zn and a molecular weight of 457.89 g/mol. Its IUPAC name is 2-hydroxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid;zinc;hydrate.
| Compound Name | 2-hydroxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid;zinc;hydrate |
|---|---|
| PubChem CID | 67943288 |
| Molecular Formula | C25H28O4Zn |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-hydroxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid;zinc;hydrate |
| SMILES | CC(C)(c1ccccc1)c1cc(C(=O)O)c(O)c(C(C)(C)c2ccccc2)c1.O.[Zn] |
| InChI | InChI=1S/C25H26O3.H2O.Zn/c1-24(2,17-11-7-5-8-12-17)19-15-20(23(27)28)22(26)21(16-19)25(3,4)18-13-9-6-10-14-18;;/h5-16,26H,1-4H3,(H,27,28);1H2; |
| InChIKey | XXBMLBCVJYNODI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|