C32H30O6Zn — CID 70523345
zinc bis(2-carboxy-4-(2-phenylpropan-2-yl)phenolate) (PubChem CID 70523345) has the molecular formula C32H30O6Zn and a molecular weight of 575.98 g/mol. Its IUPAC name is zinc bis(2-carboxy-4-(2-phenylpropan-2-yl)phenolate).
| Compound Name | zinc bis(2-carboxy-4-(2-phenylpropan-2-yl)phenolate) |
|---|---|
| PubChem CID | 70523345 |
| Molecular Formula | C32H30O6Zn |
| Molecular Weight | 575.98 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | zinc bis(2-carboxy-4-(2-phenylpropan-2-yl)phenolate) |
| SMILES | CC(C)(c1ccccc1)c1ccc([O-])c(C(=O)O)c1.CC(C)(c1ccccc1)c1ccc([O-])c(C(=O)O)c1.[Zn+2] |
| InChI | InChI=1S/2C16H16O3.Zn/c2*1-16(2,11-6-4-3-5-7-11)12-8-9-14(17)13(10-12)15(18)19;/h2*3-10,17H,1-2H3,(H,18,19);/q;;+2/p-2 |
| InChIKey | FDWCVRAOTOLRIW-UHFFFAOYSA-L |
| XLogP | 5.57 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.98 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|