C8H5NaO5 — CID 159837316
sodium 2,4-dicarboxyphenolate (PubChem CID 159837316) has the molecular formula C8H5NaO5 and a molecular weight of 204.11 g/mol. Its IUPAC name is sodium 2,4-dicarboxyphenolate.
| Compound Name | sodium 2,4-dicarboxyphenolate |
|---|---|
| PubChem CID | 159837316 |
| Molecular Formula | C8H5NaO5 |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | sodium 2,4-dicarboxyphenolate |
| SMILES | O=C(O)c1ccc([O-])c(C(=O)O)c1.[Na+] |
| InChI | InChI=1S/C8H6O5.Na/c9-6-2-1-4(7(10)11)3-5(6)8(12)13;/h1-3,9H,(H,10,11)(H,12,13);/q;+1/p-1 |
| InChIKey | NOGAEVOSXWRFFA-UHFFFAOYSA-M |
| XLogP | -2.84 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |