C8H4O6-2 — CID 54746222
3,5-dicarboxybenzene-1,2-diolate (PubChem CID 54746222) has the molecular formula C8H4O6-2 and a molecular weight of 196.11 g/mol. Its IUPAC name is 3,5-dicarboxybenzene-1,2-diolate.
| Compound Name | 3,5-dicarboxybenzene-1,2-diolate |
|---|---|
| PubChem CID | 54746222 |
| Molecular Formula | C8H4O6-2 |
| Molecular Weight | 196.11 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 3,5-dicarboxybenzene-1,2-diolate |
| SMILES | O=C(O)c1cc([O-])c([O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C8H6O6/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14)/p-2 |
| InChIKey | FBOCZYIJDQZQFE-UHFFFAOYSA-L |
| XLogP | -0.77 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.11 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |