calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid

C9H8CaO7 — CID 174724690

IUPACcalcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)c(O)c(C(=O)O)c1.[Ca+2].[H-].[H-]
InChIInChI=1S/C9H6O7.Ca.2H/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;;;/h1-2,10H,(H,11,12)(H,13,14)(H,15,16);;;/q;+2;2*-1
InChIKeyCQKRYKCTIIQBIK-UHFFFAOYSA-N
MW268.23 g/mol
LogP0.33
Rot. Bonds3

About calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid

calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid (PubChem CID 174724690) has the molecular formula C9H8CaO7 and a molecular weight of 268.23 g/mol. Its IUPAC name is calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid.

Molecular Properties

Compound Namecalcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid
PubChem CID174724690
Molecular FormulaC9H8CaO7
Molecular Weight268.23 g/mol
Exact Mass267.99
IUPAC Namecalcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid
SMILESO=C(O)c1cc(C(=O)O)c(O)c(C(=O)O)c1.[Ca+2].[H-].[H-]
InChIInChI=1S/C9H6O7.Ca.2H/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;;;/h1-2,10H,(H,11,12)(H,13,14)(H,15,16);;;/q;+2;2*-1
InChIKeyCQKRYKCTIIQBIK-UHFFFAOYSA-N
XLogP0.33
TPSA132.13 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.23
LogP ≤ 50.33
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid?
The IUPAC name of calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid (CID 174724690) is calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid.
What is the SMILES notation for calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid?
The canonical SMILES for calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid is O=C(O)c1cc(C(=O)O)c(O)c(C(=O)O)c1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid?
The InChIKey is CQKRYKCTIIQBIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O7.Ca.2H/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;;;/h1-2,10H,(H,11,12)(H,13,14)(H,15,16);;;/q;+2;2*-1.
What are the key properties of calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid?
calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid has a molecular weight of 268.23 g/mol, XLogP of 0.33, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid is sourced from PubChem (CID 174724690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).