C9H8CaO7 — CID 174724690
calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid (PubChem CID 174724690) has the molecular formula C9H8CaO7 and a molecular weight of 268.23 g/mol. Its IUPAC name is calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid.
| Compound Name | calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 174724690 |
| Molecular Formula | C9H8CaO7 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | calcium;hydride;2-hydroxybenzene-1,3,5-tricarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(O)c(C(=O)O)c1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C9H6O7.Ca.2H/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;;;/h1-2,10H,(H,11,12)(H,13,14)(H,15,16);;;/q;+2;2*-1 |
| InChIKey | CQKRYKCTIIQBIK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |