C16H11NO9 — CID 156760724
5-[(3-carboxy-2,5-dihydroxybenzoyl)amino]benzene-1,3-dicarboxylic acid (PubChem CID 156760724) has the molecular formula C16H11NO9 and a molecular weight of 361.26 g/mol. Its IUPAC name is 5-[(3-carboxy-2,5-dihydroxybenzoyl)amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(3-carboxy-2,5-dihydroxybenzoyl)amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 156760724 |
| Molecular Formula | C16H11NO9 |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 5-[(3-carboxy-2,5-dihydroxybenzoyl)amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2cc(O)cc(C(=O)O)c2O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H11NO9/c18-9-4-10(12(19)11(5-9)16(25)26)13(20)17-8-2-6(14(21)22)1-7(3-8)15(23)24/h1-5,18-19H,(H,17,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | XPDQGGANRXXTST-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|