C22H16N2O10 — CID 156760534
4-[[3-[(4-carboxy-3-hydroxyphenyl)carbamoyl]-2,5-dihydroxybenzoyl]amino]-2-hydroxybenzoic acid (PubChem CID 156760534) has the molecular formula C22H16N2O10 and a molecular weight of 468.37 g/mol. Its IUPAC name is 4-[[3-[(4-carboxy-3-hydroxyphenyl)carbamoyl]-2,5-dihydroxybenzoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[3-[(4-carboxy-3-hydroxyphenyl)carbamoyl]-2,5-dihydroxybenzoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 156760534 |
| Molecular Formula | C22H16N2O10 |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 4-[[3-[(4-carboxy-3-hydroxyphenyl)carbamoyl]-2,5-dihydroxybenzoyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cc(O)cc(C(=O)Nc3ccc(C(=O)O)c(O)c3)c2O)cc1O |
| InChI | InChI=1S/C22H16N2O10/c25-11-7-14(19(29)23-9-1-3-12(21(31)32)16(26)5-9)18(28)15(8-11)20(30)24-10-2-4-13(22(33)34)17(27)6-10/h1-8,25-28H,(H,23,29)(H,24,30)(H,31,32)(H,33,34) |
| InChIKey | FWROROGSWRBXMH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 213.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|