C14H11NO6 — CID 107721538
5-[(2,5-dihydroxybenzoyl)amino]-2-hydroxybenzoic acid (PubChem CID 107721538) has the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. Its IUPAC name is 5-[(2,5-dihydroxybenzoyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(2,5-dihydroxybenzoyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 107721538 |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 5-[(2,5-dihydroxybenzoyl)amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2cc(O)ccc2O)ccc1O |
| InChI | InChI=1S/C14H11NO6/c16-8-2-4-11(17)9(6-8)13(19)15-7-1-3-12(18)10(5-7)14(20)21/h1-6,16-18H,(H,15,19)(H,20,21) |
| InChIKey | BWTFREMMRADWLF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|