C15H15NO4 — CID 107724903
2,5-dihydroxy-N-[4-(1-hydroxyethyl)phenyl]benzamide (PubChem CID 107724903) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2,5-dihydroxy-N-[4-(1-hydroxyethyl)phenyl]benzamide.
| Compound Name | 2,5-dihydroxy-N-[4-(1-hydroxyethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 107724903 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2,5-dihydroxy-N-[4-(1-hydroxyethyl)phenyl]benzamide |
| SMILES | CC(O)c1ccc(NC(=O)c2cc(O)ccc2O)cc1 |
| InChI | InChI=1S/C15H15NO4/c1-9(17)10-2-4-11(5-3-10)16-15(20)13-8-12(18)6-7-14(13)19/h2-9,17-19H,1H3,(H,16,20) |
| InChIKey | RHSQKSIAIPFMDK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|