C13H11ClN2O3 — CID 107721355
N-(3-amino-4-chlorophenyl)-2,5-dihydroxybenzamide (PubChem CID 107721355) has the molecular formula C13H11ClN2O3 and a molecular weight of 278.70 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-2,5-dihydroxybenzamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107721355 |
| Molecular Formula | C13H11ClN2O3 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-2,5-dihydroxybenzamide |
| SMILES | Nc1cc(NC(=O)c2cc(O)ccc2O)ccc1Cl |
| InChI | InChI=1S/C13H11ClN2O3/c14-10-3-1-7(5-11(10)15)16-13(19)9-6-8(17)2-4-12(9)18/h1-6,17-18H,15H2,(H,16,19) |
| InChIKey | BXLOENJNTKZKKQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|