C15H13NO6 — CID 174687194
2-[(2,5-dihydroxybenzoyl)amino]-5-(hydroxymethyl)benzoic acid (PubChem CID 174687194) has the molecular formula C15H13NO6 and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-[(2,5-dihydroxybenzoyl)amino]-5-(hydroxymethyl)benzoic acid.
| Compound Name | 2-[(2,5-dihydroxybenzoyl)amino]-5-(hydroxymethyl)benzoic acid |
|---|---|
| PubChem CID | 174687194 |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-[(2,5-dihydroxybenzoyl)amino]-5-(hydroxymethyl)benzoic acid |
| SMILES | O=C(Nc1ccc(CO)cc1C(=O)O)c1cc(O)ccc1O |
| InChI | InChI=1S/C15H13NO6/c17-7-8-1-3-12(10(5-8)15(21)22)16-14(20)11-6-9(18)2-4-13(11)19/h1-6,17-19H,7H2,(H,16,20)(H,21,22) |
| InChIKey | FYRARDHZGHXEIU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|