C9H7F2NO4 — CID 103513232
2-[(2,2-difluoroacetyl)amino]-5-hydroxybenzoic acid (PubChem CID 103513232) has the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. Its IUPAC name is 2-[(2,2-difluoroacetyl)amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[(2,2-difluoroacetyl)amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 103513232 |
| Molecular Formula | C9H7F2NO4 |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-[(2,2-difluoroacetyl)amino]-5-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)ccc1NC(=O)C(F)F |
| InChI | InChI=1S/C9H7F2NO4/c10-7(11)8(14)12-6-2-1-4(13)3-5(6)9(15)16/h1-3,7,13H,(H,12,14)(H,15,16) |
| InChIKey | PIBPNYIBOGXQLG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|