C12H8ClNO4S — CID 43358268
4-[(5-chlorothiophene-2-carbonyl)amino]-2-hydroxybenzoic acid (PubChem CID 43358268) has the molecular formula C12H8ClNO4S and a molecular weight of 297.72 g/mol. Its IUPAC name is 4-[(5-chlorothiophene-2-carbonyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(5-chlorothiophene-2-carbonyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 43358268 |
| Molecular Formula | C12H8ClNO4S |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 4-[(5-chlorothiophene-2-carbonyl)amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)c(O)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H8ClNO4S/c13-10-4-3-9(19-10)11(16)14-6-1-2-7(12(17)18)8(15)5-6/h1-5,15H,(H,14,16)(H,17,18) |
| InChIKey | MEJPUYKNIOCTML-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |