C11H6Cl3NO2S — CID 82884384
5-chloro-N-(3,5-dichloro-4-hydroxyphenyl)thiophene-2-carboxamide (PubChem CID 82884384) has the molecular formula C11H6Cl3NO2S and a molecular weight of 322.60 g/mol. Its IUPAC name is 5-chloro-N-(3,5-dichloro-4-hydroxyphenyl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(3,5-dichloro-4-hydroxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 82884384 |
| Molecular Formula | C11H6Cl3NO2S |
| Molecular Weight | 322.60 g/mol |
| Exact Mass | 320.92 |
| IUPAC Name | 5-chloro-N-(3,5-dichloro-4-hydroxyphenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(O)c(Cl)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H6Cl3NO2S/c12-6-3-5(4-7(13)10(6)16)15-11(17)8-1-2-9(14)18-8/h1-4,16H,(H,15,17) |
| InChIKey | LLYZONXYMVKYJJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|