C10H8ClN3OS — CID 112524186
5-chloro-N-(2-methylpyrimidin-5-yl)thiophene-2-carboxamide (PubChem CID 112524186) has the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. Its IUPAC name is 5-chloro-N-(2-methylpyrimidin-5-yl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(2-methylpyrimidin-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112524186 |
| Molecular Formula | C10H8ClN3OS |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 5-chloro-N-(2-methylpyrimidin-5-yl)thiophene-2-carboxamide |
| SMILES | Cc1ncc(NC(=O)c2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C10H8ClN3OS/c1-6-12-4-7(5-13-6)14-10(15)8-2-3-9(11)16-8/h2-5H,1H3,(H,14,15) |
| InChIKey | ZYYZCXLBZMSLKV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |