C14H9ClN2OS2 — CID 17435952
5-chloro-N-[4-(1,3-thiazol-2-yl)phenyl]thiophene-2-carboxamide (PubChem CID 17435952) has the molecular formula C14H9ClN2OS2 and a molecular weight of 320.83 g/mol. Its IUPAC name is 5-chloro-N-[4-(1,3-thiazol-2-yl)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[4-(1,3-thiazol-2-yl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17435952 |
| Molecular Formula | C14H9ClN2OS2 |
| Molecular Weight | 320.83 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 5-chloro-N-[4-(1,3-thiazol-2-yl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nccs2)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H9ClN2OS2/c15-12-6-5-11(20-12)13(18)17-10-3-1-9(2-4-10)14-16-7-8-19-14/h1-8H,(H,17,18) |
| InChIKey | ANLOKPWACZIYNF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |