C19H12ClN3OS — CID 55823361
2-chloro-N-[4-(1,3-thiazol-2-yl)phenyl]quinoline-6-carboxamide (PubChem CID 55823361) has the molecular formula C19H12ClN3OS and a molecular weight of 365.85 g/mol. Its IUPAC name is 2-chloro-N-[4-(1,3-thiazol-2-yl)phenyl]quinoline-6-carboxamide.
| Compound Name | 2-chloro-N-[4-(1,3-thiazol-2-yl)phenyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 55823361 |
| Molecular Formula | C19H12ClN3OS |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 2-chloro-N-[4-(1,3-thiazol-2-yl)phenyl]quinoline-6-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nccs2)cc1)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C19H12ClN3OS/c20-17-8-4-13-11-14(3-7-16(13)23-17)18(24)22-15-5-1-12(2-6-15)19-21-9-10-25-19/h1-11H,(H,22,24) |
| InChIKey | RAJUOVCAPHSXLT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|