C14H15ClN4OS — CID 53164697
5-chloro-N-(2-piperidin-1-ylpyrimidin-5-yl)thiophene-2-carboxamide (PubChem CID 53164697) has the molecular formula C14H15ClN4OS and a molecular weight of 322.82 g/mol. Its IUPAC name is 5-chloro-N-(2-piperidin-1-ylpyrimidin-5-yl)thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(2-piperidin-1-ylpyrimidin-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 53164697 |
| Molecular Formula | C14H15ClN4OS |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 5-chloro-N-(2-piperidin-1-ylpyrimidin-5-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cnc(N2CCCCC2)nc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H15ClN4OS/c15-12-5-4-11(21-12)13(20)18-10-8-16-14(17-9-10)19-6-2-1-3-7-19/h4-5,8-9H,1-3,6-7H2,(H,18,20) |
| InChIKey | MDJGRQNAEDFRTF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |