C16H18ClN5O — CID 53164742
N-[2-(azepan-1-yl)pyrimidin-5-yl]-6-chloropyridine-3-carboxamide (PubChem CID 53164742) has the molecular formula C16H18ClN5O and a molecular weight of 331.81 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)pyrimidin-5-yl]-6-chloropyridine-3-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)pyrimidin-5-yl]-6-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 53164742 |
| Molecular Formula | C16H18ClN5O |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-[2-(azepan-1-yl)pyrimidin-5-yl]-6-chloropyridine-3-carboxamide |
| SMILES | O=C(Nc1cnc(N2CCCCCC2)nc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H18ClN5O/c17-14-6-5-12(9-18-14)15(23)21-13-10-19-16(20-11-13)22-7-3-1-2-4-8-22/h5-6,9-11H,1-4,7-8H2,(H,21,23) |
| InChIKey | CIHTURCXAWNDNW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|