C15H14F2N4O — CID 53164633
3,4-difluoro-N-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide (PubChem CID 53164633) has the molecular formula C15H14F2N4O and a molecular weight of 304.30 g/mol. Its IUPAC name is 3,4-difluoro-N-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide.
| Compound Name | 3,4-difluoro-N-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide |
|---|---|
| PubChem CID | 53164633 |
| Molecular Formula | C15H14F2N4O |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3,4-difluoro-N-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide |
| SMILES | O=C(Nc1cnc(N2CCCC2)nc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H14F2N4O/c16-12-4-3-10(7-13(12)17)14(22)20-11-8-18-15(19-9-11)21-5-1-2-6-21/h3-4,7-9H,1-2,5-6H2,(H,20,22) |
| InChIKey | GFRAFPMEYLIFBN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |