C15H15FN4O — CID 53014754
3-fluoro-N-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide (PubChem CID 53014754) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is 3-fluoro-N-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide.
| Compound Name | 3-fluoro-N-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide |
|---|---|
| PubChem CID | 53014754 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-fluoro-N-(2-pyrrolidin-1-ylpyrimidin-5-yl)benzamide |
| SMILES | O=C(Nc1cnc(N2CCCC2)nc1)c1cccc(F)c1 |
| InChI | InChI=1S/C15H15FN4O/c16-12-5-3-4-11(8-12)14(21)19-13-9-17-15(18-10-13)20-6-1-2-7-20/h3-5,8-10H,1-2,6-7H2,(H,19,21) |
| InChIKey | RJAIEGOGCJZSGO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |